C11H9ClN2O3 — CID 91380281
5-[(3-chlorophenyl)methyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 91380281) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(3-chlorophenyl)methyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91380281 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(Cc2cccc(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H9ClN2O3/c12-7-3-1-2-6(4-7)5-8-9(15)13-11(17)14-10(8)16/h1-4H,5H2,(H3,13,14,15,16,17) |
| InChIKey | GTXFODAVVUUBKB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |