C37H53NO7 — CID 91380493
2-[(9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyl)amino]propanoic acid;(5-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 91380493) has the molecular formula C37H53NO7 and a molecular weight of 623.83 g/mol. Its IUPAC name is 2-[(9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyl)amino]propanoic acid;(5-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 2-[(9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyl)amino]propanoic acid;(5-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 91380493 |
| Molecular Formula | C37H53NO7 |
| Molecular Weight | 623.83 g/mol |
| Exact Mass | 623.38 |
| IUPAC Name | 2-[(9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyl)amino]propanoic acid;(5-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(NC(=O)C1CC2CC1C1C3CC(C(C)C3C)C21)C(=O)O.CC1C(C)C2CC1C1C3CC(C(=O)OC4COC(=O)C4)C(C3)C21 |
| InChI | InChI=1S/C19H26O4.C18H27NO3/c1-8-9(2)13-6-12(8)17-10-3-14(18(13)17)15(4-10)19(21)23-11-5-16(20)22-7-11;1-7-8(2)12-6-11(7)15-10-4-13(16(12)15)14(5-10)17(20)19-9(3)18(21)22/h8-15,17-18H,3-7H2,1-2H3;7-16H,4-6H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | GLKLUSGRWYSOOK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.83 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|