C14H12N6O2S — CID 9138082
6-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 9138082) has the molecular formula C14H12N6O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 6-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 9138082 |
| Molecular Formula | C14H12N6O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 6-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(CN2c3cccc4cccc(c34)S2(=O)=O)n1 |
| InChI | InChI=1S/C14H12N6O2S/c15-13-17-11(18-14(16)19-13)7-20-9-5-1-3-8-4-2-6-10(12(8)9)23(20,21)22/h1-6H,7H2,(H4,15,16,17,18,19) |
| InChIKey | QHDZFWJJAYXWDQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |