C32H43F3N4O5 — CID 91381347
3-[[4-[1-[2-[(1Z,4E)-1-amino-6,6,6-trifluoro-5-methylhexa-1,4-dienyl]-8-tert-butyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-hydroxypropan-2-yl]benzoyl]amino]propanoic acid (PubChem CID 91381347) has the molecular formula C32H43F3N4O5 and a molecular weight of 620.71 g/mol. Its IUPAC name is 3-[[4-[1-[2-[(1Z,4E)-1-amino-6,6,6-trifluoro-5-methylhexa-1,4-dienyl]-8-tert-butyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-hydroxypropan-2-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[2-[(1Z,4E)-1-amino-6,6,6-trifluoro-5-methylhexa-1,4-dienyl]-8-tert-butyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-hydroxypropan-2-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 91381347 |
| Molecular Formula | C32H43F3N4O5 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | 3-[[4-[1-[2-[(1Z,4E)-1-amino-6,6,6-trifluoro-5-methylhexa-1,4-dienyl]-8-tert-butyl-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-hydroxypropan-2-yl]benzoyl]amino]propanoic acid |
| SMILES | C/C(=C\C/C=C(\N)C1=NC2(CCC(C(C)(C)C)CC2)N(CC(C)(O)c2ccc(C(=O)NCCC(=O)O)cc2)C1=O)C(F)(F)F |
| InChI | InChI=1S/C32H43F3N4O5/c1-20(32(33,34)35)7-6-8-24(36)26-28(43)39(31(38-26)16-13-22(14-17-31)29(2,3)4)19-30(5,44)23-11-9-21(10-12-23)27(42)37-18-15-25(40)41/h7-12,22,44H,6,13-19,36H2,1-5H3,(H,37,42)(H,40,41)/b20-7+,24-8- |
| InChIKey | ZQSHZBULPYUITR-RZSLNZOWSA-N |
| XLogP | 5.06 |
| TPSA | 145.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|