C9H12FNO4 — CID 91381389
(2R,4S)-4-fluoro-2-prop-2-enylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 91381389) has the molecular formula C9H12FNO4 and a molecular weight of 217.20 g/mol. Its IUPAC name is (2R,4S)-4-fluoro-2-prop-2-enylpyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4S)-4-fluoro-2-prop-2-enylpyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 91381389 |
| Molecular Formula | C9H12FNO4 |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | (2R,4S)-4-fluoro-2-prop-2-enylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | C=CC[C@]1(C(=O)O)C[C@H](F)CN1C(=O)O |
| InChI | InChI=1S/C9H12FNO4/c1-2-3-9(7(12)13)4-6(10)5-11(9)8(14)15/h2,6H,1,3-5H2,(H,12,13)(H,14,15)/t6-,9+/m0/s1 |
| InChIKey | XNSWJNCBRLSADU-IMTBSYHQSA-N |
| XLogP | 1.11 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|