About 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide
4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide (PubChem CID 91381429) has the molecular formula C20H27N3O4
and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide.
Molecular Properties
| Compound Name | 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide |
| PubChem CID | 91381429 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide |
| SMILES | CCC(=O)N(C)c1ccccc1NC(=O)CCCn1c(O)cc(CC)c1O |
| InChI | InChI=1S/C20H27N3O4/c1-4-14-13-19(26)23(20(14)27)12-8-11-17(24)21-15-9-6-7-10-16(15)22(3)18(25)5-2/h6-7,9-10,13,26-27H,4-5,8,11-12H2,1-3H3,(H,21,24) |
| InChIKey | HXMKBWCDQIBKFM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide?
The IUPAC name of 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide (CID 91381429) is 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide.
What is the SMILES notation for 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide?
The canonical SMILES for 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide is CCC(=O)N(C)c1ccccc1NC(=O)CCCn1c(O)cc(CC)c1O.
What is the InChIKey of 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide?
The InChIKey is HXMKBWCDQIBKFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O4/c1-4-14-13-19(26)23(20(14)27)12-8-11-17(24)21-15-9-6-7-10-16(15)22(3)18(25)5-2/h6-7,9-10,13,26-27H,4-5,8,11-12H2,1-3H3,(H,21,24).
What are the key properties of 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide?
4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide has a molecular weight of 373.45 g/mol, XLogP of 3.25, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethyl-2,5-dihydroxypyrrol-1-yl)-N-[2-[methyl(propanoyl)amino]phenyl]butanamide is sourced from PubChem (CID 91381429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).