C30H54N6 — CID 91381536
4,19,31,32,34,35-hexazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriacontane (PubChem CID 91381536) has the molecular formula C30H54N6 and a molecular weight of 498.80 g/mol. Its IUPAC name is 4,19,31,32,34,35-hexazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriacontane.
| Compound Name | 4,19,31,32,34,35-hexazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriacontane |
|---|---|
| PubChem CID | 91381536 |
| Molecular Formula | C30H54N6 |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 498.44 |
| IUPAC Name | 4,19,31,32,34,35-hexazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriacontane |
| SMILES | C1NC2CC1CC1CCC(CC3CCC(CC4CC(CN4)CC4CCC(CC5CCC(C2)N5)N4)N3)N1 |
| InChI | InChI=1S/C30H54N6/c1-3-23-13-25-5-7-27(35-25)16-30-12-20(18-32-30)10-22-2-4-24(34-22)14-26-6-8-28(36-26)15-29-11-19(17-31-29)9-21(1)33-23/h19-36H,1-18H2 |
| InChIKey | AMUVSPGTXJKFBG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |