C29H41FN8O2Si2 — CID 91382054
5-(2-azidoethyl)-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 91382054) has the molecular formula C29H41FN8O2Si2 and a molecular weight of 608.87 g/mol. Its IUPAC name is 5-(2-azidoethyl)-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(2-azidoethyl)-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 91382054 |
| Molecular Formula | C29H41FN8O2Si2 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | 5-(2-azidoethyl)-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(CCN=[N+]=[N-])nc2c(-c3cnc4ccc(F)cc4c3)cnn12 |
| InChI | InChI=1S/C29H41FN8O2Si2/c1-41(2,3)13-11-39-20-37(21-40-12-14-42(4,5)6)28-17-25(9-10-33-36-31)35-29-26(19-34-38(28)29)23-15-22-16-24(30)7-8-27(22)32-18-23/h7-8,15-19H,9-14,20-21H2,1-6H3 |
| InChIKey | HTJQOJUFWOFPFP-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|