C16H13FN2O4 — CID 91382107
(5S)-2-(3-fluoro-4-isocyanophenyl)-7-methyl-5,6-dihydro-4H-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 91382107) has the molecular formula C16H13FN2O4 and a molecular weight of 316.29 g/mol. Its IUPAC name is (5S)-2-(3-fluoro-4-isocyanophenyl)-7-methyl-5,6-dihydro-4H-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | (5S)-2-(3-fluoro-4-isocyanophenyl)-7-methyl-5,6-dihydro-4H-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 91382107 |
| Molecular Formula | C16H13FN2O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (5S)-2-(3-fluoro-4-isocyanophenyl)-7-methyl-5,6-dihydro-4H-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(C)C[C@H](O)C3O2)cc1F |
| InChI | InChI=1S/C16H13FN2O4/c1-16-6-10(20)13(23-16)11-12(16)15(22)19(14(11)21)7-3-4-9(18-2)8(17)5-7/h3-5,10,13,20-22H,6H2,1H3/t10-,13?,16?/m0/s1 |
| InChIKey | IIFDINHZPOVNBG-UFRSZFPASA-N |
| XLogP | 2.63 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|