C27H31N3O3S — CID 91382611
tert-butyl 6-[5-(6-methyl-5-propan-2-yloxycyclohepta-1,3,4,6-tetraen-1-yl)-1,3,4-thiadiazol-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 91382611) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is tert-butyl 6-[5-(6-methyl-5-propan-2-yloxycyclohepta-1,3,4,6-tetraen-1-yl)-1,3,4-thiadiazol-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 6-[5-(6-methyl-5-propan-2-yloxycyclohepta-1,3,4,6-tetraen-1-yl)-1,3,4-thiadiazol-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 91382611 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | tert-butyl 6-[5-(6-methyl-5-propan-2-yloxycyclohepta-1,3,4,6-tetraen-1-yl)-1,3,4-thiadiazol-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC1=CC(c2nnc(-c3ccc4c(c3)CCN(C(=O)OC(C)(C)C)C4)s2)=CC=C=C1OC(C)C |
| InChI | InChI=1S/C27H31N3O3S/c1-17(2)32-23-9-7-8-20(14-18(23)3)24-28-29-25(34-24)21-10-11-22-16-30(13-12-19(22)15-21)26(31)33-27(4,5)6/h7-8,10-11,14-15,17H,12-13,16H2,1-6H3 |
| InChIKey | SBGDIBZMTPBXST-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |