C12H9ClF4N4O — CID 91382730
5-chloro-4-imidazol-1-yl-6-(3,4,4,4-tetrafluoro-2-methylidenebutoxy)pyrimidine (PubChem CID 91382730) has the molecular formula C12H9ClF4N4O and a molecular weight of 336.68 g/mol. Its IUPAC name is 5-chloro-4-imidazol-1-yl-6-(3,4,4,4-tetrafluoro-2-methylidenebutoxy)pyrimidine.
| Compound Name | 5-chloro-4-imidazol-1-yl-6-(3,4,4,4-tetrafluoro-2-methylidenebutoxy)pyrimidine |
|---|---|
| PubChem CID | 91382730 |
| Molecular Formula | C12H9ClF4N4O |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 5-chloro-4-imidazol-1-yl-6-(3,4,4,4-tetrafluoro-2-methylidenebutoxy)pyrimidine |
| SMILES | C=C(COc1ncnc(-n2ccnc2)c1Cl)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H9ClF4N4O/c1-7(9(14)12(15,16)17)4-22-11-8(13)10(19-5-20-11)21-3-2-18-6-21/h2-3,5-6,9H,1,4H2 |
| InChIKey | KMGRYUCJYQXCDH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|