C22H26O2 — CID 91383142
ethyl 4-[3-[2-(2,6-dimethylphenyl)ethenyl]phenyl]butanoate (PubChem CID 91383142) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is ethyl 4-[3-[2-(2,6-dimethylphenyl)ethenyl]phenyl]butanoate.
| Compound Name | ethyl 4-[3-[2-(2,6-dimethylphenyl)ethenyl]phenyl]butanoate |
|---|---|
| PubChem CID | 91383142 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | ethyl 4-[3-[2-(2,6-dimethylphenyl)ethenyl]phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1cccc(C=Cc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C22H26O2/c1-4-24-22(23)13-7-12-19-10-6-11-20(16-19)14-15-21-17(2)8-5-9-18(21)3/h5-6,8-11,14-16H,4,7,12-13H2,1-3H3 |
| InChIKey | LZJFKKVZXHYRKH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|