C18H30BrNO6P8 — CID 91383243
bis[bis(phosphanyl)phosphanyl]-phosphanylphosphane;1-O-(2,5-dioxopyrrolidin-1-yl) 5-O-phenyl 2-bromo-2,4,4-trimethylpentanedioate (PubChem CID 91383243) has the molecular formula C18H30BrNO6P8 and a molecular weight of 684.13 g/mol. Its IUPAC name is bis[bis(phosphanyl)phosphanyl]-phosphanylphosphane;1-O-(2,5-dioxopyrrolidin-1-yl) 5-O-phenyl 2-bromo-2,4,4-trimethylpentanedioate.
| Compound Name | bis[bis(phosphanyl)phosphanyl]-phosphanylphosphane;1-O-(2,5-dioxopyrrolidin-1-yl) 5-O-phenyl 2-bromo-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 91383243 |
| Molecular Formula | C18H30BrNO6P8 |
| Molecular Weight | 684.13 g/mol |
| Exact Mass | 682.92 |
| IUPAC Name | bis[bis(phosphanyl)phosphanyl]-phosphanylphosphane;1-O-(2,5-dioxopyrrolidin-1-yl) 5-O-phenyl 2-bromo-2,4,4-trimethylpentanedioate |
| SMILES | CC(C)(CC(C)(Br)C(=O)ON1C(=O)CCC1=O)C(=O)Oc1ccccc1.PP(P)P(P)P(P)P |
| InChI | InChI=1S/C18H20BrNO6.H10P8/c1-17(2,15(23)25-12-7-5-4-6-8-12)11-18(3,19)16(24)26-20-13(21)9-10-14(20)22;1-6(2)8(5)7(3)4/h4-8H,9-11H2,1-3H3;1-5H2 |
| InChIKey | BDJDTQNEKVMCGL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.13 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|