C22H23BrO3 — CID 91383711
4-[5-(4-bromophenyl)-2-methylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 91383711) has the molecular formula C22H23BrO3 and a molecular weight of 415.33 g/mol. Its IUPAC name is 4-[5-(4-bromophenyl)-2-methylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[5-(4-bromophenyl)-2-methylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 91383711 |
| Molecular Formula | C22H23BrO3 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 4-[5-(4-bromophenyl)-2-methylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | Cc1ccc(-c2ccc(Br)cc2)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C22H23BrO3/c1-13-6-7-15(14-8-10-16(23)11-9-14)12-17(13)18-19(24)21(2,3)26-22(4,5)20(18)25/h6-12,18H,1-5H3 |
| InChIKey | LDBGZBXPRBWYMT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|