C28H41F2N5O3 — CID 91383940
(2S)-2-[(6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-N-[1-[1-[(4-hydroxyoxan-4-yl)methylamino]-2-methylpropan-2-yl]imidazol-4-yl]pentanamide (PubChem CID 91383940) has the molecular formula C28H41F2N5O3 and a molecular weight of 533.66 g/mol. Its IUPAC name is (2S)-2-[(6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-N-[1-[1-[(4-hydroxyoxan-4-yl)methylamino]-2-methylpropan-2-yl]imidazol-4-yl]pentanamide.
| Compound Name | (2S)-2-[(6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-N-[1-[1-[(4-hydroxyoxan-4-yl)methylamino]-2-methylpropan-2-yl]imidazol-4-yl]pentanamide |
|---|---|
| PubChem CID | 91383940 |
| Molecular Formula | C28H41F2N5O3 |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.32 |
| IUPAC Name | (2S)-2-[(6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-N-[1-[1-[(4-hydroxyoxan-4-yl)methylamino]-2-methylpropan-2-yl]imidazol-4-yl]pentanamide |
| SMILES | CCC[C@H](NC1CCc2cc(F)cc(F)c2C1)C(=O)Nc1cn(C(C)(C)CNCC2(O)CCOCC2)cn1 |
| InChI | InChI=1S/C28H41F2N5O3/c1-4-5-24(33-21-7-6-19-12-20(29)13-23(30)22(19)14-21)26(36)34-25-15-35(18-32-25)27(2,3)16-31-17-28(37)8-10-38-11-9-28/h12-13,15,18,21,24,31,33,37H,4-11,14,16-17H2,1-3H3,(H,34,36)/t21?,24-/m0/s1 |
| InChIKey | JNPJYDQCSCHPEB-FHZUCYEKSA-N |
| XLogP | 3.28 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |