C24H24N4O5S — CID 91384702
ethyl 4-[3-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enoate (PubChem CID 91384702) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is ethyl 4-[3-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enoate.
| Compound Name | ethyl 4-[3-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 91384702 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | ethyl 4-[3-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)N1CCc2c(sc3ncnc(N[C@H](C(=O)OC)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C24H24N4O5S/c1-3-33-19(30)10-9-18(29)28-12-11-16-17(13-28)34-23-20(16)22(25-14-26-23)27-21(24(31)32-2)15-7-5-4-6-8-15/h4-10,14,21H,3,11-13H2,1-2H3,(H,25,26,27)/t21-/m0/s1 |
| InChIKey | VQUDWHFXWOLRQP-NRFANRHFSA-N |
| XLogP | 3.02 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|