About 2-(2,6-diiodophenyl)-1,3-diiodobenzene
2-(2,6-diiodophenyl)-1,3-diiodobenzene (PubChem CID 91384938) has the molecular formula C12H6I4
and a molecular weight of 657.80 g/mol. Its IUPAC name is 2-(2,6-diiodophenyl)-1,3-diiodobenzene.
Molecular Properties
| Compound Name | 2-(2,6-diiodophenyl)-1,3-diiodobenzene |
| PubChem CID | 91384938 |
| Molecular Formula | C12H6I4 |
| Molecular Weight | 657.80 g/mol |
| Exact Mass | 657.66 |
| IUPAC Name | 2-(2,6-diiodophenyl)-1,3-diiodobenzene |
| SMILES | Ic1cccc(I)c1-c1c(I)cccc1I |
| InChI | InChI=1S/C12H6I4/c13-7-3-1-4-8(14)11(7)12-9(15)5-2-6-10(12)16/h1-6H |
| InChIKey | RGDLYUXIBRECJJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 657.80 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-diiodophenyl)-1,3-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-diiodophenyl)-1,3-diiodobenzene?
The IUPAC name of 2-(2,6-diiodophenyl)-1,3-diiodobenzene (CID 91384938) is 2-(2,6-diiodophenyl)-1,3-diiodobenzene.
What is the SMILES notation for 2-(2,6-diiodophenyl)-1,3-diiodobenzene?
The canonical SMILES for 2-(2,6-diiodophenyl)-1,3-diiodobenzene is Ic1cccc(I)c1-c1c(I)cccc1I.
What is the InChIKey of 2-(2,6-diiodophenyl)-1,3-diiodobenzene?
The InChIKey is RGDLYUXIBRECJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6I4/c13-7-3-1-4-8(14)11(7)12-9(15)5-2-6-10(12)16/h1-6H.
What are the key properties of 2-(2,6-diiodophenyl)-1,3-diiodobenzene?
2-(2,6-diiodophenyl)-1,3-diiodobenzene has a molecular weight of 657.80 g/mol, XLogP of 5.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diiodophenyl)-1,3-diiodobenzene is sourced from PubChem (CID 91384938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).