C19H20O8 — CID 91385080
2-[11-(1,2,2,3,3-pentahydroxypropyl)-6,11-dihydrobenzo[c][1]benzoxepin-2-yl]acetic acid (PubChem CID 91385080) has the molecular formula C19H20O8 and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-[11-(1,2,2,3,3-pentahydroxypropyl)-6,11-dihydrobenzo[c][1]benzoxepin-2-yl]acetic acid.
| Compound Name | 2-[11-(1,2,2,3,3-pentahydroxypropyl)-6,11-dihydrobenzo[c][1]benzoxepin-2-yl]acetic acid |
|---|---|
| PubChem CID | 91385080 |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[11-(1,2,2,3,3-pentahydroxypropyl)-6,11-dihydrobenzo[c][1]benzoxepin-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1)C(C(O)C(O)(O)C(O)O)c1ccccc1CO2 |
| InChI | InChI=1S/C19H20O8/c20-15(21)8-10-5-6-14-13(7-10)16(17(22)19(25,26)18(23)24)12-4-2-1-3-11(12)9-27-14/h1-7,16-18,22-26H,8-9H2,(H,20,21) |
| InChIKey | BHJREAREBMOZDC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|