C7H9NO4 — CID 91385113
(1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid (PubChem CID 91385113) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid.
| Compound Name | (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91385113 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2C[C@H]2CN1C(=O)O |
| InChI | InChI=1S/C7H9NO4/c9-6(10)5-4-1-3(4)2-8(5)7(11)12/h3-5H,1-2H2,(H,9,10)(H,11,12)/t3-,4-,5-/m0/s1 |
| InChIKey | ZXNDWVDSVLPGNK-YUPRTTJUSA-N |
| XLogP | 0.07 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |