C26H28F3N5O3 — CID 91385964
N-[3-(2-methylpyrazol-3-yl)-4-[2-[4-(2-oxoethyl)piperazin-1-yl]ethoxy]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 91385964) has the molecular formula C26H28F3N5O3 and a molecular weight of 515.54 g/mol. Its IUPAC name is N-[3-(2-methylpyrazol-3-yl)-4-[2-[4-(2-oxoethyl)piperazin-1-yl]ethoxy]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(2-methylpyrazol-3-yl)-4-[2-[4-(2-oxoethyl)piperazin-1-yl]ethoxy]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91385964 |
| Molecular Formula | C26H28F3N5O3 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | N-[3-(2-methylpyrazol-3-yl)-4-[2-[4-(2-oxoethyl)piperazin-1-yl]ethoxy]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cn1nccc1-c1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1OCCN1CCN(CC=O)CC1 |
| InChI | InChI=1S/C26H28F3N5O3/c1-32-23(7-8-30-32)22-18-21(31-25(36)19-3-2-4-20(17-19)26(27,28)29)5-6-24(22)37-16-14-34-11-9-33(10-12-34)13-15-35/h2-8,15,17-18H,9-14,16H2,1H3,(H,31,36) |
| InChIKey | GFJDVEKDPUTEMN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|