C19H33BN2O2 — CID 91386086
CID 91386086 (PubChem CID 91386086) has the molecular formula C19H33BN2O2 and a molecular weight of 332.30 g/mol.
| Compound Name | CID 91386086 |
|---|---|
| PubChem CID | 91386086 |
| Molecular Formula | C19H33BN2O2 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | — |
| SMILES | CC.CC.[B]C(O)(c1ccc(NC(C)=O)cc1)C1CCN(C)CC1 |
| InChI | InChI=1S/C15H21BN2O2.2C2H6/c1-11(19)17-14-5-3-12(4-6-14)15(16,20)13-7-9-18(2)10-8-13;2*1-2/h3-6,13,20H,7-10H2,1-2H3,(H,17,19);2*1-2H3 |
| InChIKey | OEHZBEPRRYBIPL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|