C14H8F6N2O10S2 — CID 91386140
[3,5,9,11-tetrahydroxy-10-(trifluoromethylsulfonyloxy)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] trifluoromethanesulfonate (PubChem CID 91386140) has the molecular formula C14H8F6N2O10S2 and a molecular weight of 542.34 g/mol. Its IUPAC name is [3,5,9,11-tetrahydroxy-10-(trifluoromethylsulfonyloxy)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] trifluoromethanesulfonate.
| Compound Name | [3,5,9,11-tetrahydroxy-10-(trifluoromethylsulfonyloxy)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91386140 |
| Molecular Formula | C14H8F6N2O10S2 |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 541.95 |
| IUPAC Name | [3,5,9,11-tetrahydroxy-10-(trifluoromethylsulfonyloxy)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)C1C=CC2c2c1c(O)n(OS(=O)(=O)C(F)(F)F)c2O)C(F)(F)F |
| InChI | InChI=1S/C14H8F6N2O10S2/c15-13(16,17)33(27,28)31-21-9(23)5-3-1-2-4(7(5)11(21)25)8-6(3)10(24)22(12(8)26)32-34(29,30)14(18,19)20/h1-4,23-26H |
| InChIKey | AFGOFRUQDXTXJY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|