C24H27F3N2O3 — CID 91386188
N-[[5,7-dipropyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]-2-(4-ethylphenyl)acetamide (PubChem CID 91386188) has the molecular formula C24H27F3N2O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[[5,7-dipropyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[[5,7-dipropyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 91386188 |
| Molecular Formula | C24H27F3N2O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[[5,7-dipropyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]-2-(4-ethylphenyl)acetamide |
| SMILES | CCCc1cc2c(C(F)(F)F)noc2c(CCC)c1ONC(=O)Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C24H27F3N2O3/c1-4-7-17-14-19-22(32-29-23(19)24(25,26)27)18(8-5-2)21(17)31-28-20(30)13-16-11-9-15(6-3)10-12-16/h9-12,14H,4-8,13H2,1-3H3,(H,28,30) |
| InChIKey | KJQMOAFUHBEMQL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|