C22H33ClO5S — CID 91386205
5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-methoxycyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 91386205) has the molecular formula C22H33ClO5S and a molecular weight of 445.02 g/mol. Its IUPAC name is 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-methoxycyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-methoxycyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 91386205 |
| Molecular Formula | C22H33ClO5S |
| Molecular Weight | 445.02 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-methoxycyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | CO[C@@H]1C[C@@H](Cl)[C@H](CCCc2ccc(C(=O)O)s2)[C@H]1C=C[C@@H](O)CCC[C@@H](C)O |
| InChI | InChI=1S/C22H33ClO5S/c1-14(24)5-3-6-15(25)9-11-18-17(19(23)13-20(18)28-2)8-4-7-16-10-12-21(29-16)22(26)27/h9-12,14-15,17-20,24-25H,3-8,13H2,1-2H3,(H,26,27)/t14-,15+,17-,18-,19-,20-/m1/s1 |
| InChIKey | QETLDZMPQRGTKQ-WFDVMHAPSA-N |
| XLogP | 4.50 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.02 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|