C10H13N5O — CID 91386863
4-(2-azidoethyl)-5,6,7,8-tetrahydro-2H-phthalazin-1-one (PubChem CID 91386863) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 4-(2-azidoethyl)-5,6,7,8-tetrahydro-2H-phthalazin-1-one.
| Compound Name | 4-(2-azidoethyl)-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 91386863 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-(2-azidoethyl)-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
| SMILES | [N-]=[N+]=NCCc1n[nH]c(=O)c2c1CCCC2 |
| InChI | InChI=1S/C10H13N5O/c11-15-12-6-5-9-7-3-1-2-4-8(7)10(16)14-13-9/h1-6H2,(H,14,16) |
| InChIKey | CYLQRVNTNALQSX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|