C27H35BN6O6S — CID 91386886
9H-fluoren-9-ylmethyl N-[amino-[3-[2-[[2-amino-3-[deuterio(tritio)boranyl]sulfanyloxypropanoyl]amino]propanoylamino]-2-tritiooxypiperidin-1-yl]methylidene]carbamate (PubChem CID 91386886) has the molecular formula C27H35BN6O6S and a molecular weight of 587.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[amino-[3-[2-[[2-amino-3-[deuterio(tritio)boranyl]sulfanyloxypropanoyl]amino]propanoylamino]-2-tritiooxypiperidin-1-yl]methylidene]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[amino-[3-[2-[[2-amino-3-[deuterio(tritio)boranyl]sulfanyloxypropanoyl]amino]propanoylamino]-2-tritiooxypiperidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 91386886 |
| Molecular Formula | C27H35BN6O6S |
| Molecular Weight | 587.51 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[amino-[3-[2-[[2-amino-3-[deuterio(tritio)boranyl]sulfanyloxypropanoyl]amino]propanoylamino]-2-tritiooxypiperidin-1-yl]methylidene]carbamate |
| SMILES | [2H]B([3H])SOCC(N)C(=O)NC(C)C(=O)NC1CCCN(C(N)=NC(=O)OCC2c3ccccc3-c3ccccc32)C1O[3H] |
| InChI | InChI=1S/C27H35BN6O6S/c1-15(31-24(36)21(29)14-40-41-28)23(35)32-22-11-6-12-34(25(22)37)26(30)33-27(38)39-13-20-18-9-4-2-7-16(18)17-8-3-5-10-19(17)20/h2-5,7-10,15,20-22,25,37H,6,11-14,28-29H2,1H3,(H,31,36)(H,32,35)(H2,30,33,38)/i28TD,37T |
| InChIKey | XXPYQRVHBCFQFE-TZKYNIFDSA-N |
| XLogP | 0.19 |
| TPSA | 181.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.51 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|