C23H24N2O2 — CID 9138694
2-methyl-N-[(2S)-3-methyl-1-(naphthalen-2-ylamino)-1-oxobutan-2-yl]benzamide (PubChem CID 9138694) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-methyl-N-[(2S)-3-methyl-1-(naphthalen-2-ylamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-methyl-N-[(2S)-3-methyl-1-(naphthalen-2-ylamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9138694 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-methyl-N-[(2S)-3-methyl-1-(naphthalen-2-ylamino)-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H](C(=O)Nc1ccc2ccccc2c1)C(C)C |
| InChI | InChI=1S/C23H24N2O2/c1-15(2)21(25-22(26)20-11-7-4-8-16(20)3)23(27)24-19-13-12-17-9-5-6-10-18(17)14-19/h4-15,21H,1-3H3,(H,24,27)(H,25,26)/t21-/m0/s1 |
| InChIKey | XIKDZATYFADCLB-NRFANRHFSA-N |
| XLogP | 4.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |