C10H12FN — CID 91387274
7-fluoro-2,3,5a,9a-tetrahydro-1H-2-benzazepine (PubChem CID 91387274) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 7-fluoro-2,3,5a,9a-tetrahydro-1H-2-benzazepine.
| Compound Name | 7-fluoro-2,3,5a,9a-tetrahydro-1H-2-benzazepine |
|---|---|
| PubChem CID | 91387274 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 7-fluoro-2,3,5a,9a-tetrahydro-1H-2-benzazepine |
| SMILES | FC1=CC2C=CCNCC2C=C1 |
| InChI | InChI=1S/C10H12FN/c11-10-4-3-9-7-12-5-1-2-8(9)6-10/h1-4,6,8-9,12H,5,7H2 |
| InChIKey | VQTBQZHUVHWZFP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|