C26H29FN6O6 — CID 91387320
methyl 9-[[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methylcarbamoyl]-7,8-dioxospiro[2,4,5,9-tetrahydropyrido[1,2-d][1,4]oxazepine-10,4'-piperidine]-1'-carboxylate (PubChem CID 91387320) has the molecular formula C26H29FN6O6 and a molecular weight of 540.55 g/mol. Its IUPAC name is methyl 9-[[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methylcarbamoyl]-7,8-dioxospiro[2,4,5,9-tetrahydropyrido[1,2-d][1,4]oxazepine-10,4'-piperidine]-1'-carboxylate.
| Compound Name | methyl 9-[[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methylcarbamoyl]-7,8-dioxospiro[2,4,5,9-tetrahydropyrido[1,2-d][1,4]oxazepine-10,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 91387320 |
| Molecular Formula | C26H29FN6O6 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | methyl 9-[[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methylcarbamoyl]-7,8-dioxospiro[2,4,5,9-tetrahydropyrido[1,2-d][1,4]oxazepine-10,4'-piperidine]-1'-carboxylate |
| SMILES | COC(=O)N1CCC2(CC1)C1=CCOCCN1C(=O)C(=O)C2C(=O)NCc1ccc(F)cc1-n1ncnc1C |
| InChI | InChI=1S/C26H29FN6O6/c1-16-29-15-30-33(16)19-13-18(27)4-3-17(19)14-28-23(35)21-22(34)24(36)32-10-12-39-11-5-20(32)26(21)6-8-31(9-7-26)25(37)38-2/h3-5,13,15,21H,6-12,14H2,1-2H3,(H,28,35) |
| InChIKey | AOQQCFCTKCXTLB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|