C9H17NO3 — CID 91387504
2-(3-ethyloxetan-3-yl)oxy-N,N-dimethylacetamide (PubChem CID 91387504) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(3-ethyloxetan-3-yl)oxy-N,N-dimethylacetamide.
| Compound Name | 2-(3-ethyloxetan-3-yl)oxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 91387504 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-(3-ethyloxetan-3-yl)oxy-N,N-dimethylacetamide |
| SMILES | CCC1(OCC(=O)N(C)C)COC1 |
| InChI | InChI=1S/C9H17NO3/c1-4-9(6-12-7-9)13-5-8(11)10(2)3/h4-7H2,1-3H3 |
| InChIKey | QOQSZKRWYAVGFQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |