C14H10O6 — CID 91387906
4a,6-dihydroxy-5-methoxyfluorene-2,4,9-trione (PubChem CID 91387906) has the molecular formula C14H10O6 and a molecular weight of 274.23 g/mol. Its IUPAC name is 4a,6-dihydroxy-5-methoxyfluorene-2,4,9-trione.
| Compound Name | 4a,6-dihydroxy-5-methoxyfluorene-2,4,9-trione |
|---|---|
| PubChem CID | 91387906 |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4a,6-dihydroxy-5-methoxyfluorene-2,4,9-trione |
| SMILES | COc1c(O)ccc2c1C1(O)C(=O)CC(=O)C=C1C2=O |
| InChI | InChI=1S/C14H10O6/c1-20-13-9(16)3-2-7-11(13)14(19)8(12(7)18)4-6(15)5-10(14)17/h2-4,16,19H,5H2,1H3 |
| InChIKey | JRHNPNWXGOAACU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|