C18H27N5O — CID 91387990
2-methanimidoyl-N-[1-[(1-propan-2-ylpyrazol-4-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]prop-2-enamide (PubChem CID 91387990) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 2-methanimidoyl-N-[1-[(1-propan-2-ylpyrazol-4-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]prop-2-enamide.
| Compound Name | 2-methanimidoyl-N-[1-[(1-propan-2-ylpyrazol-4-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 91387990 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 2-methanimidoyl-N-[1-[(1-propan-2-ylpyrazol-4-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]prop-2-enamide |
| SMILES | [H]/N=C/C(=C)C(=O)NC1CCC2C1CCN2Cc1cnn(C(C)C)c1 |
| InChI | InChI=1S/C18H27N5O/c1-12(2)23-11-14(9-20-23)10-22-7-6-15-16(4-5-17(15)22)21-18(24)13(3)8-19/h8-9,11-12,15-17,19H,3-7,10H2,1-2H3,(H,21,24)/b19-8+ |
| InChIKey | SFTZQZMKGNUYCQ-UFWORHAWSA-N |
| XLogP | 2.14 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|