C9H7F2NO — CID 91388658
5-(2,6-difluorophenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 91388658) has the molecular formula C9H7F2NO and a molecular weight of 183.16 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(2,6-difluorophenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91388658 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 5-(2,6-difluorophenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | Fc1cccc(F)c1C1C=CNO1 |
| InChI | InChI=1S/C9H7F2NO/c10-6-2-1-3-7(11)9(6)8-4-5-12-13-8/h1-5,8,12H |
| InChIKey | NIFDGNUVBNCYJO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |