C24H18F3N5O4 — CID 91388976
(5R)-5-[[1-hydroxy-6-(2,2,2-trifluoroethoxy)isoindol-2-yl]methyl]-5-(4-pyrazin-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 91388976) has the molecular formula C24H18F3N5O4 and a molecular weight of 497.43 g/mol. Its IUPAC name is (5R)-5-[[1-hydroxy-6-(2,2,2-trifluoroethoxy)isoindol-2-yl]methyl]-5-(4-pyrazin-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[1-hydroxy-6-(2,2,2-trifluoroethoxy)isoindol-2-yl]methyl]-5-(4-pyrazin-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91388976 |
| Molecular Formula | C24H18F3N5O4 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (5R)-5-[[1-hydroxy-6-(2,2,2-trifluoroethoxy)isoindol-2-yl]methyl]-5-(4-pyrazin-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](Cn2cc3ccc(OCC(F)(F)F)cc3c2O)(c2ccc(-c3cnccn3)cc2)N1 |
| InChI | InChI=1S/C24H18F3N5O4/c25-24(26,27)13-36-17-6-3-15-11-32(20(33)18(15)9-17)12-23(21(34)30-22(35)31-23)16-4-1-14(2-5-16)19-10-28-7-8-29-19/h1-11,33H,12-13H2,(H2,30,31,34,35)/t23-/m0/s1 |
| InChIKey | IDFAHGVISZLRPY-QHCPKHFHSA-N |
| XLogP | 3.48 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|