C24H27NO6 — CID 9138938
1,3-benzodioxol-5-yl (2R,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxylate (PubChem CID 9138938) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (2R,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl (2R,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 9138938 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1,3-benzodioxol-5-yl (2R,3S)-1-butyl-2-(2-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
| SMILES | CCCCN1C(=O)CC[C@H](C(=O)Oc2ccc3c(c2)OCO3)[C@@H]1c1ccccc1OC |
| InChI | InChI=1S/C24H27NO6/c1-3-4-13-25-22(26)12-10-18(23(25)17-7-5-6-8-19(17)28-2)24(27)31-16-9-11-20-21(14-16)30-15-29-20/h5-9,11,14,18,23H,3-4,10,12-13,15H2,1-2H3/t18-,23-/m0/s1 |
| InChIKey | KPSMISWRIXFDOL-MBSDFSHPSA-N |
| XLogP | 4.11 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|