C11H13NO3 — CID 91389609
7a-(oxiran-2-ylmethyl)-4,5-dihydro-3aH-isoindole-1,3-dione (PubChem CID 91389609) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 7a-(oxiran-2-ylmethyl)-4,5-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | 7a-(oxiran-2-ylmethyl)-4,5-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 91389609 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 7a-(oxiran-2-ylmethyl)-4,5-dihydro-3aH-isoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2(CC3CO3)C=CCCC12 |
| InChI | InChI=1S/C11H13NO3/c13-9-8-3-1-2-4-11(8,10(14)12-9)5-7-6-15-7/h2,4,7-8H,1,3,5-6H2,(H,12,13,14) |
| InChIKey | GIHKUISQFULHQA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|