About 1-methoxy-2H-isoindole
1-methoxy-2H-isoindole (PubChem CID 91389894) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-methoxy-2H-isoindole.
Molecular Properties
| Compound Name | 1-methoxy-2H-isoindole |
| PubChem CID | 91389894 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-methoxy-2H-isoindole |
| SMILES | COc1[nH]cc2ccccc12 |
| InChI | InChI=1S/C9H9NO/c1-11-9-8-5-3-2-4-7(8)6-10-9/h2-6,10H,1H3 |
| InChIKey | XWACOSRTCVIMQE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxy-2H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2H-isoindole?
The IUPAC name of 1-methoxy-2H-isoindole (CID 91389894) is 1-methoxy-2H-isoindole.
What is the SMILES notation for 1-methoxy-2H-isoindole?
The canonical SMILES for 1-methoxy-2H-isoindole is COc1[nH]cc2ccccc12.
What is the InChIKey of 1-methoxy-2H-isoindole?
The InChIKey is XWACOSRTCVIMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-11-9-8-5-3-2-4-7(8)6-10-9/h2-6,10H,1H3.
What are the key properties of 1-methoxy-2H-isoindole?
1-methoxy-2H-isoindole has a molecular weight of 147.18 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2H-isoindole is sourced from PubChem (CID 91389894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).