C43H64BrN2O4+ — CID 91389935
N-[1-[4-bromo-1-[(5-ethenyl-6-methoxy-1-benzofuran-7-yl)oxy]heptan-3-yl]pyridin-1-ium-4-yl]-3,7-dimethyl-9-(2,2,6-trimethylcyclohexyl)nonanamide (PubChem CID 91389935) has the molecular formula C43H64BrN2O4+ and a molecular weight of 752.90 g/mol. Its IUPAC name is N-[1-[4-bromo-1-[(5-ethenyl-6-methoxy-1-benzofuran-7-yl)oxy]heptan-3-yl]pyridin-1-ium-4-yl]-3,7-dimethyl-9-(2,2,6-trimethylcyclohexyl)nonanamide.
| Compound Name | N-[1-[4-bromo-1-[(5-ethenyl-6-methoxy-1-benzofuran-7-yl)oxy]heptan-3-yl]pyridin-1-ium-4-yl]-3,7-dimethyl-9-(2,2,6-trimethylcyclohexyl)nonanamide |
|---|---|
| PubChem CID | 91389935 |
| Molecular Formula | C43H64BrN2O4+ |
| Molecular Weight | 752.90 g/mol |
| Exact Mass | 751.40 |
| IUPAC Name | N-[1-[4-bromo-1-[(5-ethenyl-6-methoxy-1-benzofuran-7-yl)oxy]heptan-3-yl]pyridin-1-ium-4-yl]-3,7-dimethyl-9-(2,2,6-trimethylcyclohexyl)nonanamide |
| SMILES | C=Cc1cc2ccoc2c(OCCC(C(Br)CCC)[n+]2ccc(NC(=O)CC(C)CCCC(C)CCC3C(C)CCCC3(C)C)cc2)c1OC |
| InChI | InChI=1S/C43H63BrN2O4/c1-9-13-37(44)38(22-27-50-42-40(48-8)33(10-2)29-34-21-26-49-41(34)42)46-24-19-35(20-25-46)45-39(47)28-31(4)15-11-14-30(3)17-18-36-32(5)16-12-23-43(36,6)7/h10,19-21,24-26,29-32,36-38H,2,9,11-18,22-23,27-28H2,1,3-8H3/p+1 |
| InChIKey | MALKGTAXDFFJTA-UHFFFAOYSA-O |
| XLogP | 11.96 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.90 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|