C14H15N3O4S — CID 91390049
6-(5-cyanopentyl)-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid (PubChem CID 91390049) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 6-(5-cyanopentyl)-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid.
| Compound Name | 6-(5-cyanopentyl)-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91390049 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 6-(5-cyanopentyl)-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid |
| SMILES | Cc1c(=O)n(CCCCCC#N)c(=O)n2cc(C(=O)O)sc12 |
| InChI | InChI=1S/C14H15N3O4S/c1-9-11(18)16(7-5-3-2-4-6-15)14(21)17-8-10(13(19)20)22-12(9)17/h8H,2-5,7H2,1H3,(H,19,20) |
| InChIKey | NVYNWVZRDIAQJZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|