C18H26F6 — CID 91390271
3,3,7-trimethyl-4-[5,5,5-trifluoro-2,4-dimethyl-4-(trifluoromethyl)pentyl]tricyclo[4.1.0.02,4]heptane (PubChem CID 91390271) has the molecular formula C18H26F6 and a molecular weight of 356.39 g/mol. Its IUPAC name is 3,3,7-trimethyl-4-[5,5,5-trifluoro-2,4-dimethyl-4-(trifluoromethyl)pentyl]tricyclo[4.1.0.02,4]heptane.
| Compound Name | 3,3,7-trimethyl-4-[5,5,5-trifluoro-2,4-dimethyl-4-(trifluoromethyl)pentyl]tricyclo[4.1.0.02,4]heptane |
|---|---|
| PubChem CID | 91390271 |
| Molecular Formula | C18H26F6 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3,3,7-trimethyl-4-[5,5,5-trifluoro-2,4-dimethyl-4-(trifluoromethyl)pentyl]tricyclo[4.1.0.02,4]heptane |
| SMILES | CC(CC12CC3C(C)C3C1C2(C)C)CC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H26F6/c1-9(6-15(5,17(19,20)21)18(22,23)24)7-16-8-11-10(2)12(11)13(16)14(16,3)4/h9-13H,6-8H2,1-5H3 |
| InChIKey | IRQAYVLCUPBHRV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |