C32H39BrN4 — CID 91390308
17-bromo-2,3,7,8,12,13-hexaethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 91390308) has the molecular formula C32H39BrN4 and a molecular weight of 559.60 g/mol. Its IUPAC name is 17-bromo-2,3,7,8,12,13-hexaethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 17-bromo-2,3,7,8,12,13-hexaethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91390308 |
| Molecular Formula | C32H39BrN4 |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 17-bromo-2,3,7,8,12,13-hexaethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCc1c2[nH]c(c1CC)C=c1[nH]c(c(CC)c1CC)=Cc1[nH]c(cc1Br)C=c1[nH]c(c(CC)c1CC)=C2 |
| InChI | InChI=1S/C32H39BrN4/c1-7-19-20(8-2)27-15-28-21(9-3)22(10-4)29(36-28)16-30-23(11-5)24(12-6)31(37-30)17-32-25(33)13-18(34-32)14-26(19)35-27/h13-17,34-37H,7-12H2,1-6H3 |
| InChIKey | YZGRFAIXFQMVIC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |