C16H8F4N2O2 — CID 91390458
4-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 91390458) has the molecular formula C16H8F4N2O2 and a molecular weight of 336.24 g/mol. Its IUPAC name is 4-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 91390458 |
| Molecular Formula | C16H8F4N2O2 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-[(1S,7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3C2)c(F)c1F |
| InChI | InChI=1S/C16H8F4N2O2/c17-10-7(4-21)11(18)13(20)14(12(10)19)22-15(23)8-5-1-2-6(3-5)9(8)16(22)24/h1-2,5-6,23-24H,3H2/t5-,6+ |
| InChIKey | HDSLNNCXEWEBMH-OLQVQODUSA-N |
| XLogP | 3.46 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|