C47H45Cl2F3N2O2 — CID 91390985
2-[2-(tert-butylamino)-5-chlorophenyl]pent-3-yn-2-ol;2-[5-chloro-2-(tritylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 91390985) has the molecular formula C47H45Cl2F3N2O2 and a molecular weight of 797.79 g/mol. Its IUPAC name is 2-[2-(tert-butylamino)-5-chlorophenyl]pent-3-yn-2-ol;2-[5-chloro-2-(tritylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | 2-[2-(tert-butylamino)-5-chlorophenyl]pent-3-yn-2-ol;2-[5-chloro-2-(tritylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 91390985 |
| Molecular Formula | C47H45Cl2F3N2O2 |
| Molecular Weight | 797.79 g/mol |
| Exact Mass | 796.28 |
| IUPAC Name | 2-[2-(tert-butylamino)-5-chlorophenyl]pent-3-yn-2-ol;2-[5-chloro-2-(tritylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | CC#CC(C)(O)c1cc(Cl)ccc1NC(C)(C)C.OC(C#CC1CC1)(c1cc(Cl)ccc1NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C32H25ClF3NO.C15H20ClNO/c33-27-18-19-29(28(22-27)30(38,32(34,35)36)21-20-23-16-17-23)37-31(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26;1-6-9-15(5,18)12-10-11(16)7-8-13(12)17-14(2,3)4/h1-15,18-19,22-23,37-38H,16-17H2;7-8,10,17-18H,1-5H3 |
| InChIKey | AXMAMSIKQZFJOE-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.79 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|