About oxetan-2-yl N,N-diethylcarbamate
oxetan-2-yl N,N-diethylcarbamate (PubChem CID 91391054) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is oxetan-2-yl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | oxetan-2-yl N,N-diethylcarbamate |
| PubChem CID | 91391054 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | oxetan-2-yl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC1CCO1 |
| InChI | InChI=1S/C8H15NO3/c1-3-9(4-2)8(10)12-7-5-6-11-7/h7H,3-6H2,1-2H3 |
| InChIKey | XWWIMOMPXQKHEX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxetan-2-yl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-2-yl N,N-diethylcarbamate?
The IUPAC name of oxetan-2-yl N,N-diethylcarbamate (CID 91391054) is oxetan-2-yl N,N-diethylcarbamate.
What is the SMILES notation for oxetan-2-yl N,N-diethylcarbamate?
The canonical SMILES for oxetan-2-yl N,N-diethylcarbamate is CCN(CC)C(=O)OC1CCO1.
What is the InChIKey of oxetan-2-yl N,N-diethylcarbamate?
The InChIKey is XWWIMOMPXQKHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-3-9(4-2)8(10)12-7-5-6-11-7/h7H,3-6H2,1-2H3.
What are the key properties of oxetan-2-yl N,N-diethylcarbamate?
oxetan-2-yl N,N-diethylcarbamate has a molecular weight of 173.21 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-2-yl N,N-diethylcarbamate is sourced from PubChem (CID 91391054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).