About 8-chloro-4H-2,3-benzodiazepine
8-chloro-4H-2,3-benzodiazepine (PubChem CID 91391055) has the molecular formula C9H7ClN2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 8-chloro-4H-2,3-benzodiazepine.
Molecular Properties
| Compound Name | 8-chloro-4H-2,3-benzodiazepine |
| PubChem CID | 91391055 |
| Molecular Formula | C9H7ClN2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 8-chloro-4H-2,3-benzodiazepine |
| SMILES | Clc1ccc2c(c1)=CN=NCC=2 |
| InChI | InChI=1S/C9H7ClN2/c10-9-2-1-7-3-4-11-12-6-8(7)5-9/h1-3,5-6H,4H2 |
| InChIKey | BHMFLVSQCDTIFW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-4H-2,3-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4H-2,3-benzodiazepine?
The IUPAC name of 8-chloro-4H-2,3-benzodiazepine (CID 91391055) is 8-chloro-4H-2,3-benzodiazepine.
What is the SMILES notation for 8-chloro-4H-2,3-benzodiazepine?
The canonical SMILES for 8-chloro-4H-2,3-benzodiazepine is Clc1ccc2c(c1)=CN=NCC=2.
What is the InChIKey of 8-chloro-4H-2,3-benzodiazepine?
The InChIKey is BHMFLVSQCDTIFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2/c10-9-2-1-7-3-4-11-12-6-8(7)5-9/h1-3,5-6H,4H2.
What are the key properties of 8-chloro-4H-2,3-benzodiazepine?
8-chloro-4H-2,3-benzodiazepine has a molecular weight of 178.62 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4H-2,3-benzodiazepine is sourced from PubChem (CID 91391055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).