C52H60N2O6S2 — CID 91391362
N-[4-[9,10-dioxo-4-[[2-(2,5,5-trimethylheptan-2-ylsulfanyl)acetyl]amino]anthracen-1-yl]-9,10-dioxoanthracen-1-yl]-2-(2,5,5-trimethylheptan-2-ylsulfanyl)acetamide (PubChem CID 91391362) has the molecular formula C52H60N2O6S2 and a molecular weight of 873.19 g/mol. Its IUPAC name is N-[4-[9,10-dioxo-4-[[2-(2,5,5-trimethylheptan-2-ylsulfanyl)acetyl]amino]anthracen-1-yl]-9,10-dioxoanthracen-1-yl]-2-(2,5,5-trimethylheptan-2-ylsulfanyl)acetamide.
| Compound Name | N-[4-[9,10-dioxo-4-[[2-(2,5,5-trimethylheptan-2-ylsulfanyl)acetyl]amino]anthracen-1-yl]-9,10-dioxoanthracen-1-yl]-2-(2,5,5-trimethylheptan-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 91391362 |
| Molecular Formula | C52H60N2O6S2 |
| Molecular Weight | 873.19 g/mol |
| Exact Mass | 872.39 |
| IUPAC Name | N-[4-[9,10-dioxo-4-[[2-(2,5,5-trimethylheptan-2-ylsulfanyl)acetyl]amino]anthracen-1-yl]-9,10-dioxoanthracen-1-yl]-2-(2,5,5-trimethylheptan-2-ylsulfanyl)acetamide |
| SMILES | CCC(C)(C)CCC(C)(C)SCC(=O)Nc1ccc(-c2ccc(NC(=O)CSC(C)(C)CCC(C)(C)CC)c3c2C(=O)c2ccccc2C3=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C52H60N2O6S2/c1-11-49(3,4)25-27-51(7,8)61-29-39(55)53-37-23-21-31(41-43(37)47(59)35-19-15-13-17-33(35)45(41)57)32-22-24-38(44-42(32)46(58)34-18-14-16-20-36(34)48(44)60)54-40(56)30-62-52(9,10)28-26-50(5,6)12-2/h13-24H,11-12,25-30H2,1-10H3,(H,53,55)(H,54,56) |
| InChIKey | YVMISRFEOHNFGM-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.19 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|