C46H78O3 — CID 91391425
(1S,2R,4aS,6aR,6aS,6bR,10S,12aR,14bS)-10-hexadec-9-enoxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid (PubChem CID 91391425) has the molecular formula C46H78O3 and a molecular weight of 679.13 g/mol. Its IUPAC name is (1S,2R,4aS,6aR,6aS,6bR,10S,12aR,14bS)-10-hexadec-9-enoxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | (1S,2R,4aS,6aR,6aS,6bR,10S,12aR,14bS)-10-hexadec-9-enoxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 91391425 |
| Molecular Formula | C46H78O3 |
| Molecular Weight | 679.13 g/mol |
| Exact Mass | 678.60 |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,10S,12aR,14bS)-10-hexadec-9-enoxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| SMILES | CCCCCCC=CCCCCCCCCO[C@H]1CC[C@@]2(C)C(CC[C@]3(C)[C@@H]2CC=C2[C@@H]4[C@@H](C)[C@H](C)CC[C@]4(C(=O)O)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C46H78O3/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-33-49-39-27-28-43(6)37(42(39,4)5)26-29-45(8)38(43)24-23-36-40-35(3)34(2)25-30-46(40,41(47)48)32-31-44(36,45)7/h14-15,23,34-35,37-40H,9-13,16-22,24-33H2,1-8H3,(H,47,48)/t34-,35+,37?,38-,39+,40+,43+,44-,45-,46+/m1/s1 |
| InChIKey | SKMCYEYOCQGBMJ-FIGKMTFASA-N |
| XLogP | 13.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.13 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|