About 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide
3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide (PubChem CID 91391919) has the molecular formula C18H20FN3O2
and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide.
Molecular Properties
| Compound Name | 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide |
| PubChem CID | 91391919 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide |
| SMILES | CN(C)C=CC(=O)c1ccc(Oc2ccc(F)cc2)cc1.[H]/N=C/N |
| InChI | InChI=1S/C17H16FNO2.CH4N2/c1-19(2)12-11-17(20)13-3-7-15(8-4-13)21-16-9-5-14(18)6-10-16;2-1-3/h3-12H,1-2H3;1H,(H3,2,3) |
| InChIKey | YWNHCKQMHUHVAC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide?
The IUPAC name of 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide (CID 91391919) is 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide.
What is the SMILES notation for 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide?
The canonical SMILES for 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide is CN(C)C=CC(=O)c1ccc(Oc2ccc(F)cc2)cc1.[H]/N=C/N.
What is the InChIKey of 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide?
The InChIKey is YWNHCKQMHUHVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO2.CH4N2/c1-19(2)12-11-17(20)13-3-7-15(8-4-13)21-16-9-5-14(18)6-10-16;2-1-3/h3-12H,1-2H3;1H,(H3,2,3).
What are the key properties of 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide?
3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide has a molecular weight of 329.38 g/mol, XLogP of 3.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-1-[4-(4-fluorophenoxy)phenyl]prop-2-en-1-one;methanimidamide is sourced from PubChem (CID 91391919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).