C14H25NO2 — CID 91391939
ethyl 2-(3,3-dimethylbutylimino)cyclopentane-1-carboxylate (PubChem CID 91391939) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is ethyl 2-(3,3-dimethylbutylimino)cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-(3,3-dimethylbutylimino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 91391939 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | ethyl 2-(3,3-dimethylbutylimino)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC/C1=N\CCC(C)(C)C |
| InChI | InChI=1S/C14H25NO2/c1-5-17-13(16)11-7-6-8-12(11)15-10-9-14(2,3)4/h11H,5-10H2,1-4H3/b15-12+ |
| InChIKey | FQQFJSAQAIRDII-NTCAYCPXSA-N |
| XLogP | 3.23 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|