C16H22O8 — CID 91392045
3-[4-methoxy-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]phenyl]propanoic acid (PubChem CID 91392045) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is 3-[4-methoxy-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-methoxy-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91392045 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[4-methoxy-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]phenyl]propanoic acid |
| SMILES | COc1ccc(CCC(=O)O)c([C@@]2(O)CO[C@H](CO)[C@@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C16H22O8/c1-23-10-4-2-9(3-5-13(18)19)11(6-10)16(22)8-24-12(7-17)14(20)15(16)21/h2,4,6,12,14-15,17,20-22H,3,5,7-8H2,1H3,(H,18,19)/t12-,14-,15+,16+/m1/s1 |
| InChIKey | IRZMTCZSHZIRFR-OJLVUWQFSA-N |
| XLogP | -0.99 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |